C26H41N3 — CID 144514175
4-[1-(butylamino)ethenyl]-2-N-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1-N,1-N-dipropylbenzene-1,2-diamine (PubChem CID 144514175) has the molecular formula C26H41N3 and a molecular weight of 395.64 g/mol. Its IUPAC name is 4-[1-(butylamino)ethenyl]-2-N-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1-N,1-N-dipropylbenzene-1,2-diamine.
| Compound Name | 4-[1-(butylamino)ethenyl]-2-N-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1-N,1-N-dipropylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 144514175 |
| Molecular Formula | C26H41N3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | 4-[1-(butylamino)ethenyl]-2-N-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1-N,1-N-dipropylbenzene-1,2-diamine |
| SMILES | C=C(Nc1cc(C(=C)NCCCC)ccc1N(CCC)CCC)/C(C)=C/C=C\C |
| InChI | InChI=1S/C26H41N3/c1-8-12-14-21(5)22(6)28-25-20-24(23(7)27-17-13-9-2)15-16-26(25)29(18-10-3)19-11-4/h8,12,14-16,20,27-28H,6-7,9-11,13,17-19H2,1-5H3/b12-8-,21-14+ |
| InChIKey | WNQQHSTUQAQMTD-OFLNFLCBSA-N |
| XLogP | 7.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|