C14H13ClFN3S — CID 144523388
1-(6-chlorocyclohexa-1,5-dien-1-yl)-3-[(E)-(3-fluorophenyl)methylideneamino]thiourea (PubChem CID 144523388) has the molecular formula C14H13ClFN3S and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-(6-chlorocyclohexa-1,5-dien-1-yl)-3-[(E)-(3-fluorophenyl)methylideneamino]thiourea.
| Compound Name | 1-(6-chlorocyclohexa-1,5-dien-1-yl)-3-[(E)-(3-fluorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 144523388 |
| Molecular Formula | C14H13ClFN3S |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-(6-chlorocyclohexa-1,5-dien-1-yl)-3-[(E)-(3-fluorophenyl)methylideneamino]thiourea |
| SMILES | Fc1cccc(/C=N/NC(=S)NC2=CCCC=C2Cl)c1 |
| InChI | InChI=1S/C14H13ClFN3S/c15-12-6-1-2-7-13(12)18-14(20)19-17-9-10-4-3-5-11(16)8-10/h3-9H,1-2H2,(H2,18,19,20)/b17-9+ |
| InChIKey | VUPJHFVVZQFHIC-RQZCQDPDSA-N |
| XLogP | 3.42 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|