C22H26N4S2 — CID 144525307
N'-[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylsulfanylquinolin-4-yl]propane-1,3-diamine (PubChem CID 144525307) has the molecular formula C22H26N4S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is N'-[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylsulfanylquinolin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylsulfanylquinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 144525307 |
| Molecular Formula | C22H26N4S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N'-[2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-6-methylsulfanylquinolin-4-yl]propane-1,3-diamine |
| SMILES | CSc1ccc2nc(N3CCSc4ccccc4C3)cc(NCCCN)c2c1 |
| InChI | InChI=1S/C22H26N4S2/c1-27-17-7-8-19-18(13-17)20(24-10-4-9-23)14-22(25-19)26-11-12-28-21-6-3-2-5-16(21)15-26/h2-3,5-8,13-14H,4,9-12,15,23H2,1H3,(H,24,25) |
| InChIKey | MRCRMIICFWXBMD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|