C11H19NO2 — CID 144530738
(Z,3R)-3-hydroxy-7,7-dimethyl-8-methyliminooct-5-en-2-one (PubChem CID 144530738) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (Z,3R)-3-hydroxy-7,7-dimethyl-8-methyliminooct-5-en-2-one.
| Compound Name | (Z,3R)-3-hydroxy-7,7-dimethyl-8-methyliminooct-5-en-2-one |
|---|---|
| PubChem CID | 144530738 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (Z,3R)-3-hydroxy-7,7-dimethyl-8-methyliminooct-5-en-2-one |
| SMILES | C/N=C/C(C)(C)/C=C\C[C@@H](O)C(C)=O |
| InChI | InChI=1S/C11H19NO2/c1-9(13)10(14)6-5-7-11(2,3)8-12-4/h5,7-8,10,14H,6H2,1-4H3/b7-5-,12-8+/t10-/m1/s1 |
| InChIKey | DKVBFCRZLXLSCV-MJVYYOKHSA-N |
| XLogP | 1.61 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|