C38H47NO — CID 144531276
3-[3-[1-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-2-methylpropyl]phenyl]propan-1-ol (PubChem CID 144531276) has the molecular formula C38H47NO and a molecular weight of 533.80 g/mol. Its IUPAC name is 3-[3-[1-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-2-methylpropyl]phenyl]propan-1-ol.
| Compound Name | 3-[3-[1-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-2-methylpropyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 144531276 |
| Molecular Formula | C38H47NO |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 533.37 |
| IUPAC Name | 3-[3-[1-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-2-methylpropyl]phenyl]propan-1-ol |
| SMILES | CC(C)c1ccc(N(c2ccc(C(c3cccc(CCCO)c3)C(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H47NO/c1-27(2)30-13-19-34(20-14-30)39(36-23-17-33(18-24-36)38(5,6)7)35-21-15-31(16-22-35)37(28(3)4)32-12-8-10-29(26-32)11-9-25-40/h8,10,12-24,26-28,37,40H,9,11,25H2,1-7H3 |
| InChIKey | YUBCVPWNADRFLL-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |