C18H29N3O3 — CID 144531295
3,3-dimethylhex-1-ene;7-methyl-4-nitro-2,1,3-benzoxadiazole;propane (PubChem CID 144531295) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3,3-dimethylhex-1-ene;7-methyl-4-nitro-2,1,3-benzoxadiazole;propane.
| Compound Name | 3,3-dimethylhex-1-ene;7-methyl-4-nitro-2,1,3-benzoxadiazole;propane |
|---|---|
| PubChem CID | 144531295 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 3,3-dimethylhex-1-ene;7-methyl-4-nitro-2,1,3-benzoxadiazole;propane |
| SMILES | C=CC(C)(C)CCC.CCC.Cc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C8H16.C7H5N3O3.C3H8/c1-5-7-8(3,4)6-2;1-4-2-3-5(10(11)12)7-6(4)8-13-9-7;1-3-2/h6H,2,5,7H2,1,3-4H3;2-3H,1H3;3H2,1-2H3 |
| InChIKey | ZPGGCOUWJTUBAS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|