C10H18N2O — CID 144540766
N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]butanamide;molecular hydrogen (PubChem CID 144540766) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]butanamide;molecular hydrogen.
| Compound Name | N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 144540766 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]butanamide;molecular hydrogen |
| SMILES | C=C/C=C(/CNC(=O)CCC)N=C.[H][H] |
| InChI | InChI=1S/C10H16N2O.H2/c1-4-6-9(11-3)8-12-10(13)7-5-2;/h4,6H,1,3,5,7-8H2,2H3,(H,12,13);1H/b9-6-; |
| InChIKey | MDCNYNONYSVTRM-BORNJIKYSA-N |
| XLogP | 1.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|