C18H24F2N2 — CID 144542744
(E)-3-[3-(4,4-difluoropentyl)phenyl]-N-ethenyl-N'-methylbut-2-enimidamide (PubChem CID 144542744) has the molecular formula C18H24F2N2 and a molecular weight of 306.40 g/mol. Its IUPAC name is (E)-3-[3-(4,4-difluoropentyl)phenyl]-N-ethenyl-N'-methylbut-2-enimidamide.
| Compound Name | (E)-3-[3-(4,4-difluoropentyl)phenyl]-N-ethenyl-N'-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 144542744 |
| Molecular Formula | C18H24F2N2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (E)-3-[3-(4,4-difluoropentyl)phenyl]-N-ethenyl-N'-methylbut-2-enimidamide |
| SMILES | C=CNC(/C=C(\C)c1cccc(CCCC(C)(F)F)c1)=N\C |
| InChI | InChI=1S/C18H24F2N2/c1-5-22-17(21-4)12-14(2)16-10-6-8-15(13-16)9-7-11-18(3,19)20/h5-6,8,10,12-13H,1,7,9,11H2,2-4H3,(H,21,22)/b14-12+ |
| InChIKey | SZHLAWBELGYPNR-WYMLVPIESA-N |
| XLogP | 4.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|