C8H18NO6P — CID 144547902
ethenyl N-[2-[ethoxy(methoxy)phosphoryl]oxyethyl]carbamate;molecular hydrogen (PubChem CID 144547902) has the molecular formula C8H18NO6P and a molecular weight of 255.21 g/mol. Its IUPAC name is ethenyl N-[2-[ethoxy(methoxy)phosphoryl]oxyethyl]carbamate;molecular hydrogen.
| Compound Name | ethenyl N-[2-[ethoxy(methoxy)phosphoryl]oxyethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 144547902 |
| Molecular Formula | C8H18NO6P |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | ethenyl N-[2-[ethoxy(methoxy)phosphoryl]oxyethyl]carbamate;molecular hydrogen |
| SMILES | C=COC(=O)NCCOP(=O)(OC)OCC.[H][H] |
| InChI | InChI=1S/C8H16NO6P.H2/c1-4-13-8(10)9-6-7-15-16(11,12-3)14-5-2;/h4H,1,5-7H2,2-3H3,(H,9,10);1H |
| InChIKey | SEWZZOXWVSLUSD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|