C13H31NO4Si3 — CID 87161549
ethenyl N-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]carbamate (PubChem CID 87161549) has the molecular formula C13H31NO4Si3 and a molecular weight of 349.65 g/mol. Its IUPAC name is ethenyl N-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]carbamate.
| Compound Name | ethenyl N-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 87161549 |
| Molecular Formula | C13H31NO4Si3 |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | ethenyl N-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]carbamate |
| SMILES | C=COC(=O)NCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H31NO4Si3/c1-9-16-13(15)14-11-10-12-21(8,17-19(2,3)4)18-20(5,6)7/h9H,1,10-12H2,2-8H3,(H,14,15) |
| InChIKey | MAGNPUXIOMIVNV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|