C14H27NO5Si — CID 174958071
ethenyl N-propylcarbamate;ethenyl 2-trimethylsilylethyl carbonate (PubChem CID 174958071) has the molecular formula C14H27NO5Si and a molecular weight of 317.46 g/mol. Its IUPAC name is ethenyl N-propylcarbamate;ethenyl 2-trimethylsilylethyl carbonate.
| Compound Name | ethenyl N-propylcarbamate;ethenyl 2-trimethylsilylethyl carbonate |
|---|---|
| PubChem CID | 174958071 |
| Molecular Formula | C14H27NO5Si |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethenyl N-propylcarbamate;ethenyl 2-trimethylsilylethyl carbonate |
| SMILES | C=COC(=O)NCCC.C=COC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C8H16O3Si.C6H11NO2/c1-5-10-8(9)11-6-7-12(2,3)4;1-3-5-7-6(8)9-4-2/h5H,1,6-7H2,2-4H3;4H,2-3,5H2,1H3,(H,7,8) |
| InChIKey | PXJSESPZULIJLY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|