C24H34N6O4S — CID 144552881
S-[2-acetamido-3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl] (Z,3Z)-3-[(4-methoxy-2-methylphenyl)methylidene]hex-4-enethioate (PubChem CID 144552881) has the molecular formula C24H34N6O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is S-[2-acetamido-3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl] (Z,3Z)-3-[(4-methoxy-2-methylphenyl)methylidene]hex-4-enethioate.
| Compound Name | S-[2-acetamido-3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl] (Z,3Z)-3-[(4-methoxy-2-methylphenyl)methylidene]hex-4-enethioate |
|---|---|
| PubChem CID | 144552881 |
| Molecular Formula | C24H34N6O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | S-[2-acetamido-3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl] (Z,3Z)-3-[(4-methoxy-2-methylphenyl)methylidene]hex-4-enethioate |
| SMILES | [H]/N=C(/N=C(\N)NC(=O)C(CSC(=O)CC(/C=C\C)=C/c1ccc(OC)cc1C)NC(C)=O)N(C)C |
| InChI | InChI=1S/C24H34N6O4S/c1-7-8-17(12-18-9-10-19(34-6)11-15(18)2)13-21(32)35-14-20(27-16(3)31)22(33)28-23(25)29-24(26)30(4)5/h7-12,20H,13-14H2,1-6H3,(H,27,31)(H4,25,26,28,29,33)/b8-7-,17-12+ |
| InChIKey | KODCATVTBJFKOG-SDABRJIJSA-N |
| XLogP | 2.04 |
| TPSA | 149.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|