C23H32O3 — CID 144555051
4-(2-hydroxyphenyl)butanoic acid;[(E)-oct-1-en-6-ynyl]cyclopentane (PubChem CID 144555051) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)butanoic acid;[(E)-oct-1-en-6-ynyl]cyclopentane.
| Compound Name | 4-(2-hydroxyphenyl)butanoic acid;[(E)-oct-1-en-6-ynyl]cyclopentane |
|---|---|
| PubChem CID | 144555051 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 4-(2-hydroxyphenyl)butanoic acid;[(E)-oct-1-en-6-ynyl]cyclopentane |
| SMILES | CC#CCCC/C=C/C1CCCC1.O=C(O)CCCc1ccccc1O |
| InChI | InChI=1S/C13H20.C10H12O3/c1-2-3-4-5-6-7-10-13-11-8-9-12-13;11-9-6-2-1-4-8(9)5-3-7-10(12)13/h7,10,13H,4-6,8-9,11-12H2,1H3;1-2,4,6,11H,3,5,7H2,(H,12,13)/b10-7+; |
| InChIKey | DTTPWOIDLKGBKD-HCUGZAAXSA-N |
| XLogP | 5.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|