C37H29NO2 — CID 144559187
2-[[4-(N-[(4aE,6E,7Z,10Z)-6-ethylidene-9H-benzo[8]annulen-5-yl]-4-methylanilino)phenyl]methylidene]indene-1,3-dione (PubChem CID 144559187) has the molecular formula C37H29NO2 and a molecular weight of 519.64 g/mol. Its IUPAC name is 2-[[4-(N-[(4aE,6E,7Z,10Z)-6-ethylidene-9H-benzo[8]annulen-5-yl]-4-methylanilino)phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-(N-[(4aE,6E,7Z,10Z)-6-ethylidene-9H-benzo[8]annulen-5-yl]-4-methylanilino)phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 144559187 |
| Molecular Formula | C37H29NO2 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 2-[[4-(N-[(4aE,6E,7Z,10Z)-6-ethylidene-9H-benzo[8]annulen-5-yl]-4-methylanilino)phenyl]methylidene]indene-1,3-dione |
| SMILES | C/C=C1\C=C/C/C=c2/cccc\c2=C\1N(c1ccc(C)cc1)c1ccc(C=C2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C37H29NO2/c1-3-27-10-4-5-11-28-12-6-7-13-31(28)35(27)38(29-20-16-25(2)17-21-29)30-22-18-26(19-23-30)24-34-36(39)32-14-8-9-15-33(32)37(34)40/h3-4,6-24H,5H2,1-2H3/b10-4-,27-3+,28-11-,35-31+ |
| InChIKey | FEQQVLKAKJDHQR-BFDRVRPYSA-N |
| XLogP | 7.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|