About 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium
3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium (PubChem CID 144560977) has the molecular formula C21H23O4S+
and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium.
Molecular Properties
| Compound Name | 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium |
| PubChem CID | 144560977 |
| Molecular Formula | C21H23O4S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium |
| SMILES | COc1cccc(Oc2ccc([OH+]C)cc2)c1.COc1cccc(S)c1 |
| InChI | InChI=1S/C14H14O3.C7H8OS/c1-15-11-6-8-12(9-7-11)17-14-5-3-4-13(10-14)16-2;1-8-6-3-2-4-7(9)5-6/h3-10H,1-2H3;2-5,9H,1H3/p+1 |
| InChIKey | ZEOPPRQFWIDPMZ-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 40.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium?
The IUPAC name of 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium (CID 144560977) is 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium.
What is the SMILES notation for 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium?
The canonical SMILES for 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium is COc1cccc(Oc2ccc([OH+]C)cc2)c1.COc1cccc(S)c1.
What is the InChIKey of 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium?
The InChIKey is ZEOPPRQFWIDPMZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H14O3.C7H8OS/c1-15-11-6-8-12(9-7-11)17-14-5-3-4-13(10-14)16-2;1-8-6-3-2-4-7(9)5-6/h3-10H,1-2H3;2-5,9H,1H3/p+1.
What are the key properties of 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium?
3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium has a molecular weight of 371.48 g/mol, XLogP of 5.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybenzenethiol;[4-(3-methoxyphenoxy)phenyl]-methyloxidanium is sourced from PubChem (CID 144560977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).