About ethane;3-methoxybenzenethiol;methoxymethane
ethane;3-methoxybenzenethiol;methoxymethane (PubChem CID 91142132) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is ethane;3-methoxybenzenethiol;methoxymethane.
Molecular Properties
| Compound Name | ethane;3-methoxybenzenethiol;methoxymethane |
| PubChem CID | 91142132 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | ethane;3-methoxybenzenethiol;methoxymethane |
| SMILES | CC.COC.COc1cccc(S)c1 |
| InChI | InChI=1S/C7H8OS.C2H6O.C2H6/c1-8-6-3-2-4-7(9)5-6;1-3-2;1-2/h2-5,9H,1H3;1-2H3;1-2H3 |
| InChIKey | BMASNRGMKNNMNL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methoxybenzenethiol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxybenzenethiol;methoxymethane?
The IUPAC name of ethane;3-methoxybenzenethiol;methoxymethane (CID 91142132) is ethane;3-methoxybenzenethiol;methoxymethane.
What is the SMILES notation for ethane;3-methoxybenzenethiol;methoxymethane?
The canonical SMILES for ethane;3-methoxybenzenethiol;methoxymethane is CC.COC.COc1cccc(S)c1.
What is the InChIKey of ethane;3-methoxybenzenethiol;methoxymethane?
The InChIKey is BMASNRGMKNNMNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS.C2H6O.C2H6/c1-8-6-3-2-4-7(9)5-6;1-3-2;1-2/h2-5,9H,1H3;1-2H3;1-2H3.
What are the key properties of ethane;3-methoxybenzenethiol;methoxymethane?
ethane;3-methoxybenzenethiol;methoxymethane has a molecular weight of 216.35 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxybenzenethiol;methoxymethane is sourced from PubChem (CID 91142132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).