C11H17NO2 — CID 144577777
5-(3-methylbut-2-enoxymethyl)-1,2-dihydropyridin-2-ol (PubChem CID 144577777) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-(3-methylbut-2-enoxymethyl)-1,2-dihydropyridin-2-ol.
| Compound Name | 5-(3-methylbut-2-enoxymethyl)-1,2-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 144577777 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-(3-methylbut-2-enoxymethyl)-1,2-dihydropyridin-2-ol |
| SMILES | CC(C)=CCOCC1=CNC(O)C=C1 |
| InChI | InChI=1S/C11H17NO2/c1-9(2)5-6-14-8-10-3-4-11(13)12-7-10/h3-5,7,11-13H,6,8H2,1-2H3 |
| InChIKey | XDQSWKQSVCDWPZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|