C25H22FN3O — CID 144591059
dibenzofuran;2-N-[2-[fluoro(methyl)amino]phenyl]benzene-1,2-diamine (PubChem CID 144591059) has the molecular formula C25H22FN3O and a molecular weight of 399.47 g/mol. Its IUPAC name is dibenzofuran;2-N-[2-[fluoro(methyl)amino]phenyl]benzene-1,2-diamine.
| Compound Name | dibenzofuran;2-N-[2-[fluoro(methyl)amino]phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 144591059 |
| Molecular Formula | C25H22FN3O |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | dibenzofuran;2-N-[2-[fluoro(methyl)amino]phenyl]benzene-1,2-diamine |
| SMILES | CN(F)c1ccccc1Nc1ccccc1N.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C13H14FN3.C12H8O/c1-17(14)13-9-5-4-8-12(13)16-11-7-3-2-6-10(11)15;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h2-9,16H,15H2,1H3;1-8H |
| InChIKey | ILHYVGLRGFHIPK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|