C25H38N2O — CID 144594355
N-[2,6-dimethyl-4-(4-propyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)phenyl]-3,3-dimethylbutanamide (PubChem CID 144594355) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is N-[2,6-dimethyl-4-(4-propyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2,6-dimethyl-4-(4-propyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 144594355 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | N-[2,6-dimethyl-4-(4-propyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CCCC1C=CCC2CN(c3cc(C)c(NC(=O)CC(C)(C)C)c(C)c3)CC12 |
| InChI | InChI=1S/C25H38N2O/c1-7-9-19-10-8-11-20-15-27(16-22(19)20)21-12-17(2)24(18(3)13-21)26-23(28)14-25(4,5)6/h8,10,12-13,19-20,22H,7,9,11,14-16H2,1-6H3,(H,26,28) |
| InChIKey | XSNQOOYFKQODRS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|