C23H38 — CID 144601044
ethane;6-[(Z)-pent-3-enyl]-1,2,3,3a,4,5,5a,6,7,9,10,10a,10b,10c-tetradecahydropyrene (PubChem CID 144601044) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is ethane;6-[(Z)-pent-3-enyl]-1,2,3,3a,4,5,5a,6,7,9,10,10a,10b,10c-tetradecahydropyrene.
| Compound Name | ethane;6-[(Z)-pent-3-enyl]-1,2,3,3a,4,5,5a,6,7,9,10,10a,10b,10c-tetradecahydropyrene |
|---|---|
| PubChem CID | 144601044 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | ethane;6-[(Z)-pent-3-enyl]-1,2,3,3a,4,5,5a,6,7,9,10,10a,10b,10c-tetradecahydropyrene |
| SMILES | C/C=C\CCC1CC=C2CCC3CCCC4CCC1C2C34.CC |
| InChI | InChI=1S/C21H32.C2H6/c1-2-3-4-6-15-9-10-18-12-11-16-7-5-8-17-13-14-19(15)21(18)20(16)17;1-2/h2-3,10,15-17,19-21H,4-9,11-14H2,1H3;1-2H3/b3-2-; |
| InChIKey | QKYRADRYZDFZLU-OLGQORCHSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|