C16H22O — CID 57353582
4,5,5a,6,7,8,8a,9,10,10a,10b,10c-dodecahydro-2H-pyren-1-one (PubChem CID 57353582) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 4,5,5a,6,7,8,8a,9,10,10a,10b,10c-dodecahydro-2H-pyren-1-one.
| Compound Name | 4,5,5a,6,7,8,8a,9,10,10a,10b,10c-dodecahydro-2H-pyren-1-one |
|---|---|
| PubChem CID | 57353582 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4,5,5a,6,7,8,8a,9,10,10a,10b,10c-dodecahydro-2H-pyren-1-one |
| SMILES | O=C1CC=C2CCC3CCCC4CCC1C2C34 |
| InChI | InChI=1S/C16H22O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h7,10-11,13,15-16H,1-6,8-9H2 |
| InChIKey | XIQPTKRKZRGTLA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|