C20H34BNO3 — CID 144602632
5-[N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]heptan-3-ol (PubChem CID 144602632) has the molecular formula C20H34BNO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is 5-[N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]heptan-3-ol.
| Compound Name | 5-[N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]heptan-3-ol |
|---|---|
| PubChem CID | 144602632 |
| Molecular Formula | C20H34BNO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 5-[N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]heptan-3-ol |
| SMILES | CCC(O)CC(CC)N(C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H34BNO3/c1-8-16(14-18(23)9-2)22(7)17-12-10-15(11-13-17)21-24-19(3,4)20(5,6)25-21/h10-13,16,18,23H,8-9,14H2,1-7H3 |
| InChIKey | MQFUUAWDVYHYDJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|