C46H72O6 — CID 144608873
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-bis(oxan-2-yloxy)benzoate;ethane (PubChem CID 144608873) has the molecular formula C46H72O6 and a molecular weight of 721.08 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-bis(oxan-2-yloxy)benzoate;ethane.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-bis(oxan-2-yloxy)benzoate;ethane |
|---|---|
| PubChem CID | 144608873 |
| Molecular Formula | C46H72O6 |
| Molecular Weight | 721.08 g/mol |
| Exact Mass | 720.53 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-bis(oxan-2-yloxy)benzoate;ethane |
| SMILES | CC.CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5cc(OC6CCCCO6)cc(OC6CCCCO6)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C44H66O6.C2H6/c1-29(2)11-10-12-30(3)37-17-18-38-36-16-15-32-27-33(19-21-43(32,4)39(36)20-22-44(37,38)5)50-42(45)31-25-34(48-40-13-6-8-23-46-40)28-35(26-31)49-41-14-7-9-24-47-41;1-2/h15,25-26,28-30,33,36-41H,6-14,16-24,27H2,1-5H3;1-2H3 |
| InChIKey | RMIJFSFWZFFUQE-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.08 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|