C22H26ClF3N4O — CID 144611768
[4-[2-[(5-chloro-6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]phenyl] (E)-N-methyl-2-(trifluoromethyl)pent-2-enimidate (PubChem CID 144611768) has the molecular formula C22H26ClF3N4O and a molecular weight of 454.92 g/mol. Its IUPAC name is [4-[2-[(5-chloro-6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]phenyl] (E)-N-methyl-2-(trifluoromethyl)pent-2-enimidate.
| Compound Name | [4-[2-[(5-chloro-6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]phenyl] (E)-N-methyl-2-(trifluoromethyl)pent-2-enimidate |
|---|---|
| PubChem CID | 144611768 |
| Molecular Formula | C22H26ClF3N4O |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [4-[2-[(5-chloro-6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]phenyl] (E)-N-methyl-2-(trifluoromethyl)pent-2-enimidate |
| SMILES | CC/C=C(C(=N/C)\Oc1ccc(CCNc2nc(C)nc(CC)c2Cl)cc1)/C(F)(F)F |
| InChI | InChI=1S/C22H26ClF3N4O/c1-5-7-17(22(24,25)26)21(27-4)31-16-10-8-15(9-11-16)12-13-28-20-19(23)18(6-2)29-14(3)30-20/h7-11H,5-6,12-13H2,1-4H3,(H,28,29,30)/b17-7+,27-21+ |
| InChIKey | GCGJJJQMXBVFLY-VKMAEUMXSA-N |
| XLogP | 5.96 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|