C27H32N4O2S — CID 144621895
(E)-N-ethenyl-2-methylbut-2-en-1-imine;N-methylisoquinolin-7-amine;4-(1,3,4-oxathiazinan-4-yl)benzaldehyde (PubChem CID 144621895) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is (E)-N-ethenyl-2-methylbut-2-en-1-imine;N-methylisoquinolin-7-amine;4-(1,3,4-oxathiazinan-4-yl)benzaldehyde.
| Compound Name | (E)-N-ethenyl-2-methylbut-2-en-1-imine;N-methylisoquinolin-7-amine;4-(1,3,4-oxathiazinan-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 144621895 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (E)-N-ethenyl-2-methylbut-2-en-1-imine;N-methylisoquinolin-7-amine;4-(1,3,4-oxathiazinan-4-yl)benzaldehyde |
| SMILES | C=C/N=C/C(C)=C/C.CNc1ccc2ccncc2c1.O=Cc1ccc(N2CCOCS2)cc1 |
| InChI | InChI=1S/C10H10N2.C10H11NO2S.C7H11N/c1-11-10-3-2-8-4-5-12-7-9(8)6-10;12-7-9-1-3-10(4-2-9)11-5-6-13-8-14-11;1-4-7(3)6-8-5-2/h2-7,11H,1H3;1-4,7H,5-6,8H2;4-6H,2H2,1,3H3/b;;7-4+,8-6+ |
| InChIKey | REZZTJLDDKUART-ASZCVEOFSA-N |
| XLogP | 6.38 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|