About 6-ethenylisoquinoline;N-methyl-4-phenylaniline
6-ethenylisoquinoline;N-methyl-4-phenylaniline (PubChem CID 162521379) has the molecular formula C24H22N2
and a molecular weight of 338.45 g/mol. Its IUPAC name is 6-ethenylisoquinoline;N-methyl-4-phenylaniline.
Molecular Properties
| Compound Name | 6-ethenylisoquinoline;N-methyl-4-phenylaniline |
| PubChem CID | 162521379 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 6-ethenylisoquinoline;N-methyl-4-phenylaniline |
| SMILES | C=Cc1ccc2cnccc2c1.CNc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H13N.C11H9N/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-9-3-4-11-8-12-6-5-10(11)7-9/h2-10,14H,1H3;2-8H,1H2 |
| InChIKey | KCXZFKVPQKTKQQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethenylisoquinoline;N-methyl-4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenylisoquinoline;N-methyl-4-phenylaniline?
The IUPAC name of 6-ethenylisoquinoline;N-methyl-4-phenylaniline (CID 162521379) is 6-ethenylisoquinoline;N-methyl-4-phenylaniline.
What is the SMILES notation for 6-ethenylisoquinoline;N-methyl-4-phenylaniline?
The canonical SMILES for 6-ethenylisoquinoline;N-methyl-4-phenylaniline is C=Cc1ccc2cnccc2c1.CNc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 6-ethenylisoquinoline;N-methyl-4-phenylaniline?
The InChIKey is KCXZFKVPQKTKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C11H9N/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-9-3-4-11-8-12-6-5-10(11)7-9/h2-10,14H,1H3;2-8H,1H2.
What are the key properties of 6-ethenylisoquinoline;N-methyl-4-phenylaniline?
6-ethenylisoquinoline;N-methyl-4-phenylaniline has a molecular weight of 338.45 g/mol, XLogP of 6.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenylisoquinoline;N-methyl-4-phenylaniline is sourced from PubChem (CID 162521379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).