C16H25NS — CID 144625249
2-(2,3-dimethylphenyl)-5-methyl-1,3-thiazole;ethane (PubChem CID 144625249) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-5-methyl-1,3-thiazole;ethane.
| Compound Name | 2-(2,3-dimethylphenyl)-5-methyl-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 144625249 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-5-methyl-1,3-thiazole;ethane |
| SMILES | CC.CC.Cc1cnc(-c2cccc(C)c2C)s1 |
| InChI | InChI=1S/C12H13NS.2C2H6/c1-8-5-4-6-11(10(8)3)12-13-7-9(2)14-12;2*1-2/h4-7H,1-3H3;2*1-2H3 |
| InChIKey | PHUOVUBBHMEMPI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |