C22H19N3O2 — CID 144630754
1-(2-cyclobutyl-5-nitrophenyl)-9-methylpyrido[3,4-b]indole (PubChem CID 144630754) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(2-cyclobutyl-5-nitrophenyl)-9-methylpyrido[3,4-b]indole.
| Compound Name | 1-(2-cyclobutyl-5-nitrophenyl)-9-methylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 144630754 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(2-cyclobutyl-5-nitrophenyl)-9-methylpyrido[3,4-b]indole |
| SMILES | Cn1c2ccccc2c2ccnc(-c3cc([N+](=O)[O-])ccc3C3CCC3)c21 |
| InChI | InChI=1S/C22H19N3O2/c1-24-20-8-3-2-7-17(20)18-11-12-23-21(22(18)24)19-13-15(25(26)27)9-10-16(19)14-5-4-6-14/h2-3,7-14H,4-6H2,1H3 |
| InChIKey | DGPVVRFIQGDRCG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|