C18H20O3S — CID 144636039
4-hydroxy-5-(3-methylbuta-1,3-dien-2-yl)-2-(2-phenylsulfanylethyl)-2,3-dihydropyran-6-one (PubChem CID 144636039) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-hydroxy-5-(3-methylbuta-1,3-dien-2-yl)-2-(2-phenylsulfanylethyl)-2,3-dihydropyran-6-one.
| Compound Name | 4-hydroxy-5-(3-methylbuta-1,3-dien-2-yl)-2-(2-phenylsulfanylethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 144636039 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-hydroxy-5-(3-methylbuta-1,3-dien-2-yl)-2-(2-phenylsulfanylethyl)-2,3-dihydropyran-6-one |
| SMILES | C=C(C)C(=C)C1=C(O)CC(CCSc2ccccc2)OC1=O |
| InChI | InChI=1S/C18H20O3S/c1-12(2)13(3)17-16(19)11-14(21-18(17)20)9-10-22-15-7-5-4-6-8-15/h4-8,14,19H,1,3,9-11H2,2H3 |
| InChIKey | VFTFKZVAXBZRQM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|