C24H35N7O — CID 144644541
3-[[(5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]methyl]-1-methyl-1-(2-pyridin-3-ylethyl)urea (PubChem CID 144644541) has the molecular formula C24H35N7O and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-[[(5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]methyl]-1-methyl-1-(2-pyridin-3-ylethyl)urea.
| Compound Name | 3-[[(5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]methyl]-1-methyl-1-(2-pyridin-3-ylethyl)urea |
|---|---|
| PubChem CID | 144644541 |
| Molecular Formula | C24H35N7O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 3-[[(5aR,8R,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]methyl]-1-methyl-1-(2-pyridin-3-ylethyl)urea |
| SMILES | CCCN1C[C@@H](CNC(=O)N(C)CCc2cccnc2)C[C@@H]2Cc3nc(N)ncc3C[C@H]21 |
| InChI | InChI=1S/C24H35N7O/c1-3-8-31-16-18(10-19-11-21-20(12-22(19)31)15-27-23(25)29-21)14-28-24(32)30(2)9-6-17-5-4-7-26-13-17/h4-5,7,13,15,18-19,22H,3,6,8-12,14,16H2,1-2H3,(H,28,32)(H2,25,27,29)/t18-,19-,22-/m1/s1 |
| InChIKey | KIGHSNSTPKYZOW-WOIUINJBSA-N |
| XLogP | 2.15 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |