C20H20S — CID 144645310
2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(3-methylphenyl)benzenethiol (PubChem CID 144645310) has the molecular formula C20H20S and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(3-methylphenyl)benzenethiol.
| Compound Name | 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(3-methylphenyl)benzenethiol |
|---|---|
| PubChem CID | 144645310 |
| Molecular Formula | C20H20S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(3-methylphenyl)benzenethiol |
| SMILES | C=C(/C=C\C=C/C)c1cccc(-c2cccc(C)c2)c1S |
| InChI | InChI=1S/C20H20S/c1-4-5-6-10-16(3)18-12-8-13-19(20(18)21)17-11-7-9-15(2)14-17/h4-14,21H,3H2,1-2H3/b5-4-,10-6- |
| InChIKey | ZXTSPZQDCXQHGI-ARSRRCBKSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|