C27H31NS — CID 145082992
ethane;(1Z,3Z)-5-(3-methylphenyl)hexa-1,3,5-triene-1-thiol;2-phenylaniline (PubChem CID 145082992) has the molecular formula C27H31NS and a molecular weight of 401.62 g/mol. Its IUPAC name is ethane;(1Z,3Z)-5-(3-methylphenyl)hexa-1,3,5-triene-1-thiol;2-phenylaniline.
| Compound Name | ethane;(1Z,3Z)-5-(3-methylphenyl)hexa-1,3,5-triene-1-thiol;2-phenylaniline |
|---|---|
| PubChem CID | 145082992 |
| Molecular Formula | C27H31NS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | ethane;(1Z,3Z)-5-(3-methylphenyl)hexa-1,3,5-triene-1-thiol;2-phenylaniline |
| SMILES | C=C(/C=C\C=C/S)c1cccc(C)c1.CC.Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C13H14S.C12H11N.C2H6/c1-11-6-5-8-13(10-11)12(2)7-3-4-9-14;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2/h3-10,14H,2H2,1H3;1-9H,13H2;1-2H3/b7-3-,9-4-;; |
| InChIKey | GBKRFYOVXFSMGK-ZRTJEQENSA-N |
| XLogP | 7.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|