C13H16N2 — CID 144648972
(3E)-2-methylidene-4-[[[(1Z,3Z)-penta-1,3-dienyl]amino]methyl]hexa-3,5-dienenitrile (PubChem CID 144648972) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3E)-2-methylidene-4-[[[(1Z,3Z)-penta-1,3-dienyl]amino]methyl]hexa-3,5-dienenitrile.
| Compound Name | (3E)-2-methylidene-4-[[[(1Z,3Z)-penta-1,3-dienyl]amino]methyl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 144648972 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (3E)-2-methylidene-4-[[[(1Z,3Z)-penta-1,3-dienyl]amino]methyl]hexa-3,5-dienenitrile |
| SMILES | C=C/C(=C\C(=C)C#N)CN/C=C\C=C/C |
| InChI | InChI=1S/C13H16N2/c1-4-6-7-8-15-11-13(5-2)9-12(3)10-14/h4-9,15H,2-3,11H2,1H3/b6-4-,8-7-,13-9+ |
| InChIKey | JSIHPOZYSNLUMI-ZJTNKLSGSA-N |
| XLogP | 2.86 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|