C14H15F2NOS — CID 144649600
8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine (PubChem CID 144649600) has the molecular formula C14H15F2NOS and a molecular weight of 283.34 g/mol. Its IUPAC name is 8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine.
| Compound Name | 8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine |
|---|---|
| PubChem CID | 144649600 |
| Molecular Formula | C14H15F2NOS |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 8a-(2,4-difluorophenyl)-2-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine |
| SMILES | CC1=NC2(c3ccc(F)cc3F)COCCC2CS1 |
| InChI | InChI=1S/C14H15F2NOS/c1-9-17-14(8-18-5-4-10(14)7-19-9)12-3-2-11(15)6-13(12)16/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | VHJPUIOURNJJDR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |