C20H18O — CID 144660519
(3Z,5Z)-2-methylidene-3-(4-methylphenyl)-7H-1-benzoxonine (PubChem CID 144660519) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is (3Z,5Z)-2-methylidene-3-(4-methylphenyl)-7H-1-benzoxonine.
| Compound Name | (3Z,5Z)-2-methylidene-3-(4-methylphenyl)-7H-1-benzoxonine |
|---|---|
| PubChem CID | 144660519 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3Z,5Z)-2-methylidene-3-(4-methylphenyl)-7H-1-benzoxonine |
| SMILES | C=C1Oc2ccccc2C/C=C\C=C/1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18O/c1-15-11-13-17(14-12-15)19-9-5-3-7-18-8-4-6-10-20(18)21-16(19)2/h3-6,8-14H,2,7H2,1H3/b5-3-,19-9+ |
| InChIKey | FVQPLZUFOPVRGI-HDBHHNSQSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |