C59H53N — CID 144661430
1-methyl-4-phenylbenzene;3-(4-methylphenyl)-9-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]-1,9a-dihydrocarbazole;1-methyl-4-(4-phenylphenyl)benzene (PubChem CID 144661430) has the molecular formula C59H53N and a molecular weight of 776.08 g/mol. Its IUPAC name is 1-methyl-4-phenylbenzene;3-(4-methylphenyl)-9-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]-1,9a-dihydrocarbazole;1-methyl-4-(4-phenylphenyl)benzene.
| Compound Name | 1-methyl-4-phenylbenzene;3-(4-methylphenyl)-9-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]-1,9a-dihydrocarbazole;1-methyl-4-(4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 144661430 |
| Molecular Formula | C59H53N |
| Molecular Weight | 776.08 g/mol |
| Exact Mass | 775.42 |
| IUPAC Name | 1-methyl-4-phenylbenzene;3-(4-methylphenyl)-9-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]-1,9a-dihydrocarbazole;1-methyl-4-(4-phenylphenyl)benzene |
| SMILES | C#C/C=C\C(=C/CC)N1c2ccccc2C2=CC(c3ccc(C)cc3)=CCC21.Cc1ccc(-c2ccc(-c3ccccc3)cc2)cc1.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25N.C19H16.C13H12/c1-4-6-10-23(9-5-2)28-26-12-8-7-11-24(26)25-19-22(17-18-27(25)28)21-15-13-20(3)14-16-21;1-15-7-9-17(10-8-15)19-13-11-18(12-14-19)16-5-3-2-4-6-16;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h1,6-17,19,27H,5,18H2,2-3H3;2-14H,1H3;2-10H,1H3/b10-6-,23-9+;; |
| InChIKey | ZKRYKOHFELPBKX-DHDUJVRDSA-N |
| XLogP | 15.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.08 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|