C16H13F3N2O2S — CID 144662827
N-(3-cyclopropylsulfinamoyl-4-fluorophenyl)-3,4-difluorobenzamide (PubChem CID 144662827) has the molecular formula C16H13F3N2O2S and a molecular weight of 354.35 g/mol. Its IUPAC name is N-(3-cyclopropylsulfinamoyl-4-fluorophenyl)-3,4-difluorobenzamide.
| Compound Name | N-(3-cyclopropylsulfinamoyl-4-fluorophenyl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 144662827 |
| Molecular Formula | C16H13F3N2O2S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-(3-cyclopropylsulfinamoyl-4-fluorophenyl)-3,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)NC2CC2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F3N2O2S/c17-12-5-1-9(7-14(12)19)16(22)20-11-4-6-13(18)15(8-11)24(23)21-10-2-3-10/h1,4-8,10,21H,2-3H2,(H,20,22) |
| InChIKey | SCRPVALMFLFIAX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |