C22H35N5OS2 — CID 144667883
N-[[5-[3-[4-(3-aminopropylamino)butylamino]propylamino]sulfanylthiophen-2-yl]methyl]benzamide (PubChem CID 144667883) has the molecular formula C22H35N5OS2 and a molecular weight of 449.69 g/mol. Its IUPAC name is N-[[5-[3-[4-(3-aminopropylamino)butylamino]propylamino]sulfanylthiophen-2-yl]methyl]benzamide.
| Compound Name | N-[[5-[3-[4-(3-aminopropylamino)butylamino]propylamino]sulfanylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 144667883 |
| Molecular Formula | C22H35N5OS2 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[[5-[3-[4-(3-aminopropylamino)butylamino]propylamino]sulfanylthiophen-2-yl]methyl]benzamide |
| SMILES | NCCCNCCCCNCCCNSc1ccc(CNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C22H35N5OS2/c23-12-6-15-24-13-4-5-14-25-16-7-17-27-30-21-11-10-20(29-21)18-26-22(28)19-8-2-1-3-9-19/h1-3,8-11,24-25,27H,4-7,12-18,23H2,(H,26,28) |
| InChIKey | HBCBXRHSTHXUOB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|