C24H36N4O3S2 — CID 139937739
N-[[5-[4-[2-(cyclohexylamino)ethylamino]butylsulfamoyl]thiophen-2-yl]methyl]benzamide (PubChem CID 139937739) has the molecular formula C24H36N4O3S2 and a molecular weight of 492.71 g/mol. Its IUPAC name is N-[[5-[4-[2-(cyclohexylamino)ethylamino]butylsulfamoyl]thiophen-2-yl]methyl]benzamide.
| Compound Name | N-[[5-[4-[2-(cyclohexylamino)ethylamino]butylsulfamoyl]thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 139937739 |
| Molecular Formula | C24H36N4O3S2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[[5-[4-[2-(cyclohexylamino)ethylamino]butylsulfamoyl]thiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)NCCCCNCCNC2CCCCC2)s1)c1ccccc1 |
| InChI | InChI=1S/C24H36N4O3S2/c29-24(20-9-3-1-4-10-20)27-19-22-13-14-23(32-22)33(30,31)28-16-8-7-15-25-17-18-26-21-11-5-2-6-12-21/h1,3-4,9-10,13-14,21,25-26,28H,2,5-8,11-12,15-19H2,(H,27,29) |
| InChIKey | ILXQFOUXUSCHAB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|