C10H23NS — CID 144671921
S-[(E)-4,5-dimethylhex-3-en-3-yl]thiohydroxylamine;ethane (PubChem CID 144671921) has the molecular formula C10H23NS and a molecular weight of 189.37 g/mol. Its IUPAC name is S-[(E)-4,5-dimethylhex-3-en-3-yl]thiohydroxylamine;ethane.
| Compound Name | S-[(E)-4,5-dimethylhex-3-en-3-yl]thiohydroxylamine;ethane |
|---|---|
| PubChem CID | 144671921 |
| Molecular Formula | C10H23NS |
| Molecular Weight | 189.37 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | S-[(E)-4,5-dimethylhex-3-en-3-yl]thiohydroxylamine;ethane |
| SMILES | CC.CC/C(SN)=C(/C)C(C)C |
| InChI | InChI=1S/C8H17NS.C2H6/c1-5-8(10-9)7(4)6(2)3;1-2/h6H,5,9H2,1-4H3;1-2H3/b8-7+; |
| InChIKey | AHJYSZYBAYNFSM-USRGLUTNSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|