C34H38N4O5 — CID 144691061
(3R,6R,6aR)-6-[[5-[4-[4-[4-(2-hydroxy-2-methylpropyl)pyrazol-1-yl]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane (PubChem CID 144691061) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is (3R,6R,6aR)-6-[[5-[4-[4-[4-(2-hydroxy-2-methylpropyl)pyrazol-1-yl]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane.
| Compound Name | (3R,6R,6aR)-6-[[5-[4-[4-[4-(2-hydroxy-2-methylpropyl)pyrazol-1-yl]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane |
|---|---|
| PubChem CID | 144691061 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | (3R,6R,6aR)-6-[[5-[4-[4-[4-(2-hydroxy-2-methylpropyl)pyrazol-1-yl]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane |
| SMILES | CC.CC(C)(O)Cc1cnn(-c2ccc(-c3ccc(-c4ccc5[nH]c(O[C@@H]6COC7[C@H](O)CO[C@@H]76)cc5n4)cc3)cc2)c1 |
| InChI | InChI=1S/C32H32N4O5.C2H6/c1-32(2,38)14-19-15-33-36(16-19)23-9-7-21(8-10-23)20-3-5-22(6-4-20)24-11-12-25-26(34-24)13-29(35-25)41-28-18-40-30-27(37)17-39-31(28)30;1-2/h3-13,15-16,27-28,30-31,35,37-38H,14,17-18H2,1-2H3;1-2H3/t27-,28-,30?,31-;/m1./s1 |
| InChIKey | NKVKXARHGLPRPD-KRKKRHIZSA-N |
| XLogP | 5.33 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |