C27H30N4O6 — CID 144691092
ethane;methyl 2-[1-[4-[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrazol-4-yl]acetate (PubChem CID 144691092) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is ethane;methyl 2-[1-[4-[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrazol-4-yl]acetate.
| Compound Name | ethane;methyl 2-[1-[4-[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 144691092 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | ethane;methyl 2-[1-[4-[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrazol-4-yl]acetate |
| SMILES | CC.COC(=O)Cc1cnn(-c2ccc(-c3ccc4[nH]c(O[C@@H]5COC6[C@H](O)CO[C@@H]65)cc4n3)cc2)c1 |
| InChI | InChI=1S/C25H24N4O6.C2H6/c1-32-23(31)8-14-10-26-29(11-14)16-4-2-15(3-5-16)17-6-7-18-19(27-17)9-22(28-18)35-21-13-34-24-20(30)12-33-25(21)24;1-2/h2-7,9-11,20-21,24-25,28,30H,8,12-13H2,1H3;1-2H3/t20-,21-,24?,25-;/m1./s1 |
| InChIKey | NSISYUSRIWTCJE-OOKKPWJCSA-N |
| XLogP | 3.06 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |