C21H27N5O — CID 144694890
1-[6-[2-amino-5-[(1-methylcyclopropyl)methyl]benzenecarboximidoyl]pyrimidin-4-yl]-5-methylpyrrolidin-3-ol (PubChem CID 144694890) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-[6-[2-amino-5-[(1-methylcyclopropyl)methyl]benzenecarboximidoyl]pyrimidin-4-yl]-5-methylpyrrolidin-3-ol.
| Compound Name | 1-[6-[2-amino-5-[(1-methylcyclopropyl)methyl]benzenecarboximidoyl]pyrimidin-4-yl]-5-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 144694890 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[6-[2-amino-5-[(1-methylcyclopropyl)methyl]benzenecarboximidoyl]pyrimidin-4-yl]-5-methylpyrrolidin-3-ol |
| SMILES | [H]/N=C(\c1cc(N2CC(O)CC2C)ncn1)c1cc(CC2(C)CC2)ccc1N |
| InChI | InChI=1S/C21H27N5O/c1-13-7-15(27)11-26(13)19-9-18(24-12-25-19)20(23)16-8-14(3-4-17(16)22)10-21(2)5-6-21/h3-4,8-9,12-13,15,23,27H,5-7,10-11,22H2,1-2H3/b23-20- |
| InChIKey | UAHSNQZTCVCFLO-ATJXCDBQSA-N |
| XLogP | 2.78 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|