C29H35ClFN5S2 — CID 144700798
N-[6-[1-(3-chloropropylsulfanyl)-3,6-dihydro-2H-pyridin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine;ethane (PubChem CID 144700798) has the molecular formula C29H35ClFN5S2 and a molecular weight of 572.22 g/mol. Its IUPAC name is N-[6-[1-(3-chloropropylsulfanyl)-3,6-dihydro-2H-pyridin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine;ethane.
| Compound Name | N-[6-[1-(3-chloropropylsulfanyl)-3,6-dihydro-2H-pyridin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 144700798 |
| Molecular Formula | C29H35ClFN5S2 |
| Molecular Weight | 572.22 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | N-[6-[1-(3-chloropropylsulfanyl)-3,6-dihydro-2H-pyridin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine;ethane |
| SMILES | CC.CCc1nc2ccc(C3=CCN(SCCCCl)CC3)cn2c1N(C)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C27H29ClFN5S2.C2H6/c1-3-23-26(32(2)27-31-24(18-35-27)20-5-8-22(29)9-6-20)34-17-21(7-10-25(34)30-23)19-11-14-33(15-12-19)36-16-4-13-28;1-2/h5-11,17-18H,3-4,12-16H2,1-2H3;1-2H3 |
| InChIKey | VLCZNTHTSGKNHV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.22 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|