About 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine
1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine (PubChem CID 144700941) has the molecular formula C4H11N3O2S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine.
Molecular Properties
| Compound Name | 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine |
| PubChem CID | 144700941 |
| Molecular Formula | C4H11N3O2S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine |
| SMILES | [H]/N=C(\N=C)N(C)S(C)(O)O |
| InChI | InChI=1S/C4H11N3O2S/c1-6-4(5)7(2)10(3,8)9/h5,8-9H,1H2,2-3H3/b5-4+ |
| InChIKey | KVEFCQUFNJARNF-SNAWJCMRSA-N |
| XLogP | 0.85 |
| TPSA | 79.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine?
The IUPAC name of 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine (CID 144700941) is 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine.
What is the SMILES notation for 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine?
The canonical SMILES for 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine is [H]/N=C(\N=C)N(C)S(C)(O)O.
What is the InChIKey of 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine?
The InChIKey is KVEFCQUFNJARNF-SNAWJCMRSA-N. The full InChI is InChI=1S/C4H11N3O2S/c1-6-4(5)7(2)10(3,8)9/h5,8-9H,1H2,2-3H3/b5-4+.
What are the key properties of 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine?
1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine has a molecular weight of 165.22 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dihydroxy(methyl)-λ4-sulfanyl]-1-methyl-3-methylideneguanidine is sourced from PubChem (CID 144700941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).