C23H35N3O3 — CID 144707387
ethane;ethyl (1E)-N-[1-butyl-3-methyl-2,6-dioxo-5-(2-phenylethyl)pyrimidin-4-yl]ethanimidate (PubChem CID 144707387) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is ethane;ethyl (1E)-N-[1-butyl-3-methyl-2,6-dioxo-5-(2-phenylethyl)pyrimidin-4-yl]ethanimidate.
| Compound Name | ethane;ethyl (1E)-N-[1-butyl-3-methyl-2,6-dioxo-5-(2-phenylethyl)pyrimidin-4-yl]ethanimidate |
|---|---|
| PubChem CID | 144707387 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | ethane;ethyl (1E)-N-[1-butyl-3-methyl-2,6-dioxo-5-(2-phenylethyl)pyrimidin-4-yl]ethanimidate |
| SMILES | CC.CCCCn1c(=O)c(CCc2ccccc2)c(/N=C(\C)OCC)n(C)c1=O |
| InChI | InChI=1S/C21H29N3O3.C2H6/c1-5-7-15-24-20(25)18(14-13-17-11-9-8-10-12-17)19(23(4)21(24)26)22-16(3)27-6-2;1-2/h8-12H,5-7,13-15H2,1-4H3;1-2H3/b22-16+; |
| InChIKey | BPJDZTYEKHSNJP-YHLMHSEJSA-N |
| XLogP | 4.24 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|