C25H44N4 — CID 144721570
[(2Z)-4-[2-(1-bicyclo[3.2.0]hept-4-enyl)ethyl]-5-ethyl-2-(methylidenehydrazinylidene)-1-pyridinyl]methanamine;ethane;pentane (PubChem CID 144721570) has the molecular formula C25H44N4 and a molecular weight of 400.66 g/mol. Its IUPAC name is [(2Z)-4-[2-(1-bicyclo[3.2.0]hept-4-enyl)ethyl]-5-ethyl-2-(methylidenehydrazinylidene)-1-pyridinyl]methanamine;ethane;pentane.
| Compound Name | [(2Z)-4-[2-(1-bicyclo[3.2.0]hept-4-enyl)ethyl]-5-ethyl-2-(methylidenehydrazinylidene)-1-pyridinyl]methanamine;ethane;pentane |
|---|---|
| PubChem CID | 144721570 |
| Molecular Formula | C25H44N4 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | [(2Z)-4-[2-(1-bicyclo[3.2.0]hept-4-enyl)ethyl]-5-ethyl-2-(methylidenehydrazinylidene)-1-pyridinyl]methanamine;ethane;pentane |
| SMILES | C=N/N=c1/cc(CCC23CCC=C2CC3)c(CC)cn1CN.CC.CCCCC |
| InChI | InChI=1S/C18H26N4.C5H12.C2H6/c1-3-14-12-22(13-19)17(21-20-2)11-15(14)6-9-18-8-4-5-16(18)7-10-18;1-3-5-4-2;1-2/h5,11-12H,2-4,6-10,13,19H2,1H3;3-5H2,1-2H3;1-2H3/b21-17-;; |
| InChIKey | LZRATUKZWSFXII-ZZTUKWCFSA-N |
| XLogP | 6.14 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|