About 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine
4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine (PubChem CID 144740553) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine |
| PubChem CID | 144740553 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine |
| SMILES | CCC#CC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C12H21N/c1-4-5-6-11-7-9-12(10-8-11)13(2)3/h11-12H,4,7-10H2,1-3H3 |
| InChIKey | RAIPIAAFWPRECW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine?
The IUPAC name of 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine (CID 144740553) is 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine.
What is the SMILES notation for 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine?
The canonical SMILES for 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine is CCC#CC1CCC(N(C)C)CC1.
What is the InChIKey of 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine?
The InChIKey is RAIPIAAFWPRECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-4-5-6-11-7-9-12(10-8-11)13(2)3/h11-12H,4,7-10H2,1-3H3.
What are the key properties of 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine?
4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine is sourced from PubChem (CID 144740553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).