C12H21N — CID 144740553
4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine (PubChem CID 144740553) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 144740553 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-but-1-ynyl-N,N-dimethylcyclohexan-1-amine |
| SMILES | CCC#CC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C12H21N/c1-4-5-6-11-7-9-12(10-8-11)13(2)3/h11-12H,4,7-10H2,1-3H3 |
| InChIKey | RAIPIAAFWPRECW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|