C19H19BrN2O3 — CID 144741606
N-(4-bromophenyl)-N-[(4-formylphenyl)methyl]morpholine-4-carboxamide (PubChem CID 144741606) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[(4-formylphenyl)methyl]morpholine-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-N-[(4-formylphenyl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 144741606 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-(4-bromophenyl)-N-[(4-formylphenyl)methyl]morpholine-4-carboxamide |
| SMILES | O=Cc1ccc(CN(C(=O)N2CCOCC2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H19BrN2O3/c20-17-5-7-18(8-6-17)22(19(24)21-9-11-25-12-10-21)13-15-1-3-16(14-23)4-2-15/h1-8,14H,9-13H2 |
| InChIKey | VUZHTFGHEJMCNS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|