About 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide
2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide (PubChem CID 144743524) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide.
Analyze 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide?
The IUPAC name of 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide (CID 144743524) is 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide.
What is the SMILES notation for 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide?
The canonical SMILES for 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide is CC1CC(CC(=O)N=O)=CN1.
What is the InChIKey of 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide?
The InChIKey is MUGNGJASWUTFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-2-6(4-8-5)3-7(10)9-11/h4-5,8H,2-3H2,1H3.
What are the key properties of 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide?
2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide has a molecular weight of 154.17 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-2,3-dihydro-1H-pyrrol-4-yl)-N-oxoacetamide is sourced from PubChem (CID 144743524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).